![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1999/ | 2000-09-04 22:42 | - | |
| Bond Portfolio Mgmt.pdf | 1999-08-17 21:25 | 6.7K | |
| Fixed Income Securities.pdf | 1999-09-01 15:57 | 16K | |
| Floaters & Inverse Floater.pdf | 1999-09-02 09:27 | 14K | |
| Forwards & Futures.pdf | 1999-08-17 21:26 | 68K | |
| INTERNATIONAL DIVERSIFICATION.pdf | 1999-09-19 21:07 | 1.0M | |
| LECTURE NOTES Part 2 Index and Cover.pdf | 1999-08-17 21:27 | 4.4K | |
| MORTGAGE BACKED SECURITIES.pdf | 1999-09-18 20:13 | 12M | |
| March2002/ | 2002-03-08 06:32 | - | |
| Modified Duration.pdf | 1999-08-17 21:27 | 4.3K | |
| Multiplicity of Rates.pdf | 1999-09-02 09:26 | 67K | |
| New Corporate Bonds.pdf | 2000-09-04 22:43 | 18K | |
| Outline.PDF | 2000-09-04 22:44 | 14K | |
| Swap.pdf | 1999-09-02 09:27 | 33K | |
| Tax Treatment.pdf | 1999-09-02 09:26 | 18K | |
| Term Structure.pdf | 1999-09-14 12:06 | 8.7M | |
| Title page and Index.pdf | 1999-08-17 21:36 | 4.9K | |
| YTM.pdf | 1999-09-01 15:58 | 57K | |
| debt_Assignments.pdf | 2000-09-04 22:44 | 21K | |
| multi-index models in the bond area.PDF | 2000-09-04 22:43 | 26K | |
| option valuation.pdf | 2000-09-04 22:43 | 62K | |